ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
447-53-0 1,2-Dihydronaphthalene |
|
produktnavn | 1,2-Dihydronaphthalene |
Engelsk navn | 1,2-Dihydronaphthalene;1,2-DIHYDRONAPHTHALENE;naphthalene, 1,2-dihydro- |
Molekylær Formel | C10H10 |
Molekylvekt | 130.1864 |
InChI | InChI=1/C10H10/c1-2-6-10-8-4-3-7-9(10)5-1/h1-3,5-7H,4,8H2 |
CAS-nummer | 447-53-0 |
EINECS | 207-183-8 |
Molecular Structure | |
Tetthet | 1.004g/cm3 |
Smeltepunkt | -8℃ |
Kokepunkt | 204.9°C at 760 mmHg |
Brytningsindeks | 1.572 |
Flammepunktet | 70.4°C |
Damptrykk | 0.367mmHg at 25°C |
Sikkerhet Beskrivelse | S24/25##Avoid contact with skin and eyes.:; |
MSDS |