Chemindex > 4408-60-0
NO ▼
4408-60-0 2,4,6-Trimethylphenylacetic acid |
|
| produktnavn | 2,4,6-Trimethylphenylacetic acid |
| Engelsk navn | 2,4,6-Trimethylphenylacetic acid;Mesitylacetic acid;Mesityleneacetic acid;Mesity aceti acid;VITAS-BB TBB000369;RARECHEM AL BO 0305;BENZENEACETIC ACID, 2,4,6-TRIMETHYL-;2,4,6-TRIMETHYLBENZENEACETIC ACID;2,4,6-TMPAC;2,4,6-Trimethyl phenylacetic acid;(2,4,6-trimethylphenyl)acetate |
| Molekylær Formel | C11H13O2 |
| Molekylvekt | 177.2203 |
| InChI | InChI=1/C11H14O2/c1-7-4-8(2)10(6-11(12)13)9(3)5-7/h4-5H,6H2,1-3H3,(H,12,13)/p-1 |
| CAS-nummer | 4408-60-0 |
| EINECS | 224-556-0 |
| Molecular Structure |  |
| Smeltepunkt | 167-168℃ |
| Kokepunkt | 312.9°C at 760 mmHg |
| Flammepunktet | 210°C |
| Damptrykk | 0.000219mmHg at 25°C |
| Hazard symboler |  Xi##Irritant:; |
| Risiko Koder | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| Sikkerhet Beskrivelse | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
| MSDS | |
- Hvis du planlegger å hente kjemikalier fra Kina, er det bare å gå til ChemNet kjøpesenter, vi vil få den nyeste og konkurransedyktige prisen fra kinesiske produsenter for deg.Vennligst besøk ChemNet Mall for å spørre om prisen på
2,4,6-Trimethylphenylacetic acid 4408-60-0
Kjemisk CAS-databasetjeneste leveres av ChemIndex.com 