ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
437-17-2 Triphenylcarbenium hexafluorophosphate |
|
produktnavn | Triphenylcarbenium hexafluorophosphate |
Engelsk navn | Triphenylcarbenium hexafluorophosphate;Trityl hexafluorophosphate;Tritylium hexafluorophosphate;triphenylmethylium hexafluorophosphate |
Molekylvekt | 243.3219 |
InChI | InChI=1/C19H15.F6P/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-7(2,3,4,5)6/h1-15H;/q+1;-1 |
CAS-nummer | 437-17-2 |
EINECS | 207-112-0 |
Molecular Structure | |
Smeltepunkt | 150℃ |
Hazard symboler | C##Corrosive:; |
Risiko Koder | R20/21##Harmful by inhalation and in contact with skin.||R34##Causes burns.:; |
Sikkerhet Beskrivelse | S28##After contact with skin, wash immediately with plenty of ...:; |
MSDS |