Chemindex > 433-53-4
NO ▼
methyl difluoroacetate |
|
| produktnavn | methyl difluoroacetate |
| Engelsk navn | methyl difluoroacetate;Difluoroacetic acid methyl ester;1,1,2,3,3-pentafluoroprop-1-ene;Methyl 2,2-difluoroacetate |
| Molekylær Formel | C3HF5 |
| Molekylvekt | 132.0321 |
| InChI | InChI=1/C3HF5/c4-1(2(5)6)3(7)8/h2H |
| CAS-nummer | 433-53-4 |
| EINECS | 207-089-7 |
| Molecular Structure |  |
| Tetthet | 1.335g/cm3 |
| Brytningsindeks | 1.264 |
| Damptrykk | 2220mmHg at 25°C |
| Risiko Koder | R11##Highly flammable.||R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.||R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| Sikkerhet Beskrivelse | S16##Keep away from sources of ignition - No smoking.||S23##Do not inhale gas/fumes/vapour/spray.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
| MSDS | |
- Hvis du planlegger å hente kjemikalier fra Kina, er det bare å gå til ChemNet kjøpesenter, vi vil få den nyeste og konkurransedyktige prisen fra kinesiske produsenter for deg.Vennligst besøk ChemNet Mall for å spørre om prisen på
methyl difluoroacetate 433-53-4
Kjemisk CAS-databasetjeneste leveres av ChemIndex.com 