ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
4312-99-6 1-Octen-3-one |
|
produktnavn | 1-Octen-3-one |
Engelsk navn | 1-Octen-3-one;n-Amyl vinyl ketone~n-Pentyl vinyl ketone;oct-1-en-3-one |
Molekylær Formel | C8H14O |
Molekylvekt | 126.1962 |
InChI | InChI=1/C8H14O/c1-3-5-6-7-8(9)4-2/h4H,2-3,5-7H2,1H3 |
CAS-nummer | 4312-99-6 |
EINECS | 224-327-5 |
Molecular Structure | |
Tetthet | 0.825g/cm3 |
Kokepunkt | 177°C at 760 mmHg |
Brytningsindeks | 1.422 |
Flammepunktet | 58.5°C |
Damptrykk | 1.06mmHg at 25°C |
Risiko Koder | R10##Flammable.||R36/38##Irritating to eyes and skin.:; |
Sikkerhet Beskrivelse | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |