ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
4096-21-3 1-Phenylpyrrolidine |
|
produktnavn | 1-Phenylpyrrolidine |
Engelsk navn | 1-Phenylpyrrolidine;1-phenyl-pyrrolidine |
Molekylær Formel | C10H13N |
Molekylvekt | 147.2169 |
InChI | InChI=1/C10H13N/c1-2-6-10(7-3-1)11-8-4-5-9-11/h1-3,6-7H,4-5,8-9H2 |
CAS-nummer | 4096-21-3 |
EINECS | 223-849-0 |
Molecular Structure | |
Tetthet | 1.022g/cm3 |
Kokepunkt | 237.8°C at 760 mmHg |
Brytningsindeks | 1.558 |
Flammepunktet | 89°C |
Damptrykk | 0.0439mmHg at 25°C |
Risiko Koder | R21/22##Harmful in contact with skin and if swallowed.:; |
Sikkerhet Beskrivelse | S28##After contact with skin, wash immediately with plenty of ...||S36/37##Wear suitable protective clothing and gloves.:; |
MSDS |