ChemIndex - En gratis kjemisk CAS-databaseChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
1-(3-fluorophenyl)ethanol |
|
produktnavn | 1-(3-fluorophenyl)ethanol |
Engelsk navn | 1-(3-fluorophenyl)ethanol;3-fluorophenyl methyl carbinol;3-Fluoro-alpha-methylbenzyl alcohol~3-Fluorophenyl methyl carbinol;3-Fluoro-α-methylbenzenemethanol |
Molekylær Formel | C8H9FO |
Molekylvekt | 140.1549 |
InChI | InChI=1/C8H9FO/c1-6(10)7-3-2-4-8(9)5-7/h2-6,10H,1H3 |
CAS-nummer | 402-63-1 |
EINECS | 206-950-4 |
Molecular Structure | |
Tetthet | 1.123g/cm3 |
Kokepunkt | 196.2°C at 760 mmHg |
Brytningsindeks | 1.51 |
Flammepunktet | 90.1°C |
Damptrykk | 0.251mmHg at 25°C |
Sikkerhet Beskrivelse | S24/25##Avoid contact with skin and eyes.:; |
MSDS |