ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
39978-14-8 Methyl 3-aminothiophene-4-carboxylate hydrochloride |
|
produktnavn | Methyl 3-aminothiophene-4-carboxylate hydrochloride |
Engelsk navn | Methyl 3-aminothiophene-4-carboxylate hydrochloride;methyl 4-aminothiophene-3-carboxylate hydrochloride;methyl 4-aminothiophene-3-carboxylate |
Molekylær Formel | C6H7NO2S |
Molekylvekt | 157.1903 |
InChI | InChI=1/C6H7NO2S/c1-9-6(8)4-2-10-3-5(4)7/h2-3H,7H2,1H3 |
CAS-nummer | 39978-14-8 |
Molecular Structure | |
Tetthet | 1.319g/cm3 |
Smeltepunkt | 203℃ |
Kokepunkt | 295.9°C at 760 mmHg |
Brytningsindeks | 1.598 |
Flammepunktet | 132.8°C |
Damptrykk | 0.00148mmHg at 25°C |
Sikkerhet Beskrivelse | S24/25##Avoid contact with skin and eyes.:; |
MSDS |