Chemindex > 36919-03-6
NO ▼
36919-03-6 Methyl pentafluorophenyl carbonate |
|
| produktnavn | Methyl pentafluorophenyl carbonate |
| Engelsk navn | Methyl pentafluorophenyl carbonate;Pentafluorophenyl methyl carbonate |
| Molekylær Formel | C8H3F5O3 |
| Molekylvekt | 242.0996 |
| InChI | InChI=1/C8H3F5O3/c1-15-8(14)16-7-5(12)3(10)2(9)4(11)6(7)13/h1H3 |
| CAS-nummer | 36919-03-6 |
| Molecular Structure |  |
| Tetthet | 1.567g/cm3 |
| Kokepunkt | 207.5°C at 760 mmHg |
| Brytningsindeks | 1.422 |
| Flammepunktet | 77.3°C |
| Damptrykk | 0.224mmHg at 25°C |
| Risiko Koder | R22##Harmful if swallowed.||R36/38##Irritating to eyes and skin.:; |
| Sikkerhet Beskrivelse | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
| MSDS | |
- Hvis du planlegger å hente kjemikalier fra Kina, er det bare å gå til ChemNet kjøpesenter, vi vil få den nyeste og konkurransedyktige prisen fra kinesiske produsenter for deg.Vennligst besøk
ChemNet Mall
Leverandører for 36919-03-6 (0):
Kjemisk CAS-databasetjeneste leveres av ChemIndex.com 