ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
368869-97-0 2-(2,3-dihydro-1-benzofuran-5-yl)-1,3-tiazol-4-karboksylsyre |
|
produktnavn | 2-(2,3-dihydro-1-benzofuran-5-yl)-1,3-tiazol-4-karboksylsyre |
Engelsk navn | 2-(2,3-dihydro-1-benzofuran-5-yl)-1,3-thiazole-4-carboxylic acid; |
Molekylær Formel | C12H9NO3S |
Molekylvekt | 247.2698 |
InChI | InChI=1/C12H9NO3S/c14-12(15)9-6-17-11(13-9)8-1-2-10-7(5-8)3-4-16-10/h1-2,5-6H,3-4H2,(H,14,15) |
CAS-nummer | 368869-97-0 |
Molecular Structure | ![]() |
Tetthet | 1.453g/cm3 |
Smeltepunkt | 210℃ |
Kokepunkt | 490.3°C at 760 mmHg |
Brytningsindeks | 1.668 |
Flammepunktet | 250.3°C |
Damptrykk | 1.98E-10mmHg at 25°C |
Hazard symboler | |
Risiko Koder | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Sikkerhet Beskrivelse | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
MSDS |