ChemIndex - En gratis kjemisk CAS-databaseChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
3,3'-difluorobenzophenone |
|
produktnavn | 3,3'-difluorobenzophenone |
Engelsk navn | 3,3'-difluorobenzophenone;bis(3-fluorophenyl)methanone |
Molekylær Formel | C13H8F2O |
Molekylvekt | 218.1988 |
InChI | InChI=1/C13H8F2O/c14-11-5-1-3-9(7-11)13(16)10-4-2-6-12(15)8-10/h1-8H |
CAS-nummer | 345-70-0 |
Molecular Structure | |
Tetthet | 1.239g/cm3 |
Smeltepunkt | 56-59℃ |
Kokepunkt | 316.2°C at 760 mmHg |
Brytningsindeks | 1.549 |
Flammepunktet | 121.3°C |
Damptrykk | 0.000415mmHg at 25°C |
Risiko Koder | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Sikkerhet Beskrivelse | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |