Chemindex > 344-14-9
NO ▼
dimethyl fluoromalonate |
|
| produktnavn | dimethyl fluoromalonate |
| Engelsk navn | dimethyl fluoromalonate;Fluoromalonic acid dimethyl ester;dimethyl fluoropropanedioate;2-Fluoro-malonic acid dimethyl ester |
| Molekylær Formel | C5H7FO4 |
| Molekylvekt | 150.1051 |
| InChI | InChI=1/C5H7FO4/c1-9-4(7)3(6)5(8)10-2/h3H,1-2H3 |
| CAS-nummer | 344-14-9 |
| Molecular Structure |  |
| Tetthet | 1.211g/cm3 |
| Kokepunkt | 140.3°C at 760 mmHg |
| Brytningsindeks | 1.382 |
| Flammepunktet | 38.4°C |
| Damptrykk | 6.18mmHg at 25°C |
| Risiko Koder | R34##Causes burns.:; |
| Sikkerhet Beskrivelse | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
| MSDS | |
- Hvis du planlegger å hente kjemikalier fra Kina, er det bare å gå til ChemNet kjøpesenter, vi vil få den nyeste og konkurransedyktige prisen fra kinesiske produsenter for deg.Vennligst besøk ChemNet Mall for å spørre om prisen på
dimethyl fluoromalonate 344-14-9
Kjemisk CAS-databasetjeneste leveres av ChemIndex.com 