Chemindex > 341-69-5
NO ▼
Orphenadrine hydrochloride |
|
| produktnavn | Orphenadrine hydrochloride |
| Engelsk navn | Orphenadrine hydrochloride;N,N-Dimethyl-2-(o-methyl-alpha-phenylbenzyloxy)-ethylamine hydrochloride;N,N-dimethyl-2-[(2-methylphenyl)(phenyl)methoxy]ethanamine hydrochloride (1:1);N,N-dimethyl-2-[(R)-(2-methylphenyl)(phenyl)methoxy]ethanaminium;N,N-dimethyl-2-[(S)-(2-methylphenyl)(phenyl)methoxy]ethanaminium |
| Molekylær Formel | C18H24NO |
| Molekylvekt | 270.3887 |
| InChI | InChI=1/C18H23NO/c1-15-9-7-8-12-17(15)18(20-14-13-19(2)3)16-10-5-4-6-11-16/h4-12,18H,13-14H2,1-3H3/p+1/t18-/m0/s1 |
| CAS-nummer | 341-69-5 |
| EINECS | 206-435-4 |
| Molecular Structure |  |
| Smeltepunkt | 159-162℃ |
| Kokepunkt | 363°C at 760 mmHg |
| Flammepunktet | 107.1°C |
| Damptrykk | 1.86E-05mmHg at 25°C |
| Hazard symboler |  Xn##Harmful:; |
| Risiko Koder | R20/21##Harmful by inhalation and in contact with skin.:; |
| Sikkerhet Beskrivelse | S23##Do not inhale gas/fumes/vapour/spray.:; |
| MSDS | |
- Hvis du planlegger å hente kjemikalier fra Kina, er det bare å gå til ChemNet kjøpesenter, vi vil få den nyeste og konkurransedyktige prisen fra kinesiske produsenter for deg.Vennligst besøk
ChemNet Mall
Kjemisk CAS-databasetjeneste leveres av ChemIndex.com 