Chemindex > 33904-03-9
NO ▼
33904-03-9 2,4-dimethoxyphenyl isothiocyanate |
|
| produktnavn | 2,4-dimethoxyphenyl isothiocyanate |
| Engelsk navn | 2,4-dimethoxyphenyl isothiocyanate; |
| Molekylær Formel | C9H9NO2S |
| Molekylvekt | 195.2383 |
| InChI | InChI=1/C9H9NO2S/c1-11-7-3-4-8(10-6-13)9(5-7)12-2/h3-5H,1-2H3 |
| CAS-nummer | 33904-03-9 |
| Molecular Structure |  |
| Tetthet | 1.12g/cm3 |
| Smeltepunkt | 51℃ |
| Kokepunkt | 331°C at 760 mmHg |
| Brytningsindeks | 1.537 |
| Flammepunktet | 154°C |
| Damptrykk | 0.000308mmHg at 25°C |
| Hazard symboler |  Xn##Harmful:; |
| Risiko Koder | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.||R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| Sikkerhet Beskrivelse | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
| MSDS | |
- Hvis du planlegger å hente kjemikalier fra Kina, er det bare å gå til ChemNet kjøpesenter, vi vil få den nyeste og konkurransedyktige prisen fra kinesiske produsenter for deg.Vennligst besøk
ChemNet Mall
Leverandører for 33904-03-9 (0):
Kjemisk CAS-databasetjeneste leveres av ChemIndex.com 