ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
33305-08-7 methyl 1,3-thiazolane-2-carboxylate hydrochloride |
|
produktnavn | methyl 1,3-thiazolane-2-carboxylate hydrochloride |
Engelsk navn | methyl 1,3-thiazolane-2-carboxylate hydrochloride;methyl 1,3-thiazolidine-2-carboxylate hydrochloride |
Molekylær Formel | C5H10ClNO2S |
Molekylvekt | 183.6564 |
InChI | InChI=1/C5H9NO2S.ClH/c1-8-5(7)4-6-2-3-9-4;/h4,6H,2-3H2,1H3;1H |
CAS-nummer | 33305-08-7 |
EINECS | 256-726-5 |
Molecular Structure | |
Smeltepunkt | 159-163℃ (dec.) |
Kokepunkt | 238.9°C at 760 mmHg |
Flammepunktet | 98.3°C |
Damptrykk | 0.0413mmHg at 25°C |
Hazard symboler | Xn##Harmful:; |
Risiko Koder | R22##Harmful if swallowed.||R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Sikkerhet Beskrivelse | S22||S24/25:; |
MSDS |