ChemIndex - En gratis kjemisk CAS-databaseChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
3-fluoro-4-methoxybenzonitrile |
|
produktnavn | 3-fluoro-4-methoxybenzonitrile |
Engelsk navn | 3-fluoro-4-methoxybenzonitrile;Fluoromethoxybenzonitrile |
Molekylær Formel | C8H6FNO |
Molekylvekt | 151.1377 |
InChI | InChI=1/C8H6FNO/c1-11-8-3-2-6(5-10)4-7(8)9/h2-4H,1H3 |
CAS-nummer | 331-62-4 |
Molecular Structure | |
Tetthet | 1.18g/cm3 |
Kokepunkt | 254.3°C at 760 mmHg |
Brytningsindeks | 1.505 |
Flammepunktet | 107.6°C |
Damptrykk | 0.0173mmHg at 25°C |
Risiko Koder | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.:; |
Sikkerhet Beskrivelse | S22##Do not inhale dust.||S36/37##Wear suitable protective clothing and gloves.:; |
MSDS |