ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
324-42-5 2-fluor-6-metylnaftalen |
|
produktnavn | 2-fluor-6-metylnaftalen |
Engelsk navn | 2-fluoro-6-methylnaphthalene; |
Molekylær Formel | C11H9F |
Molekylvekt | 160.1876 |
InChI | InChI=1/C11H9F/c1-8-2-3-10-7-11(12)5-4-9(10)6-8/h2-7H,1H3 |
CAS-nummer | 324-42-5 |
Molecular Structure | ![]() |
Tetthet | 1.112g/cm3 |
Smeltepunkt | 72℃ |
Kokepunkt | 247.5°C at 760 mmHg |
Brytningsindeks | 1.594 |
Flammepunktet | 84.5°C |
Damptrykk | 0.0403mmHg at 25°C |
Hazard symboler | |
Risiko Koder | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Sikkerhet Beskrivelse | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
MSDS |