ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
322-46-3 Pyrido[2,3-b]pyrazine |
|
produktnavn | Pyrido[2,3-b]pyrazine |
Engelsk navn | Pyrido[2,3-b]pyrazine;1,4,5-Triazanaphthalene;Pyrido(2,3-b)pyrazine;Pyridopyrazine |
Molekylær Formel | C7H5N3 |
Molekylvekt | 131.1347 |
InChI | InChI=1/C7H5N3/c1-2-6-7(9-3-1)10-5-4-8-6/h1-5H |
CAS-nummer | 322-46-3 |
EINECS | 206-294-9 |
Molecular Structure | ![]() |
Tetthet | 1.27g/cm3 |
Smeltepunkt | 139-143℃ |
Kokepunkt | 253.9°C at 760 mmHg |
Brytningsindeks | 1.665 |
Flammepunktet | 115.9°C |
Damptrykk | 0.0284mmHg at 25°C |
Hazard symboler | |
Risiko Koder | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.||R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Sikkerhet Beskrivelse | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
MSDS |