ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
32122-11-5 Methyl 4-benzyloxybenzoate |
|
produktnavn | Methyl 4-benzyloxybenzoate |
Engelsk navn | Methyl 4-benzyloxybenzoate;4-Benzyloxybenzoic acid methyl ester |
Molekylær Formel | C15H14O3 |
Molekylvekt | 242.2699 |
InChI | InChI=1/C15H14O3/c1-17-15(16)13-7-9-14(10-8-13)18-11-12-5-3-2-4-6-12/h2-10H,11H2,1H3 |
CAS-nummer | 32122-11-5 |
Molecular Structure | |
Tetthet | 1.142g/cm3 |
Kokepunkt | 372.5°C at 760 mmHg |
Brytningsindeks | 1.566 |
Flammepunktet | 156.2°C |
Damptrykk | 9.56E-06mmHg at 25°C |
Sikkerhet Beskrivelse | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.:; |
MSDS |