ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
321-64-2 Tacrine |
|
produktnavn | Tacrine |
Engelsk navn | Tacrine;THA;1,2,3,4-Tetrahydro-9-acridinamine;9-Amino-1,2,3,4-tetrahydroacridine;Cognex;9-Acridinamine, 1,2,3,4-tetrahydro-;1,2,3,4-Tetrahydro-acridin-9-ylamine |
Molekylær Formel | C13H14N2.HCl.H2O |
Molekylvekt | 252.74 |
InChI | InChI=1/C13H14N2/c14-13-9-5-1-3-7-11(9)15-12-8-4-2-6-10(12)13/h1,3,5,7H,2,4,6,8H2,(H2,14,15) |
CAS-nummer | 321-64-2 |
EINECS | 206-291-2 |
Molecular Structure | ![]() |
Smeltepunkt | 283-284℃ |
Hazard symboler | |
Risiko Koder | R25##Toxic if swallowed.:; |
Sikkerhet Beskrivelse | S28A##After contact with skin, wash immediately with plenty of water.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |