ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
312-21-0 4-(Trifluoromethylsulfonyl)benzonitrile |
|
produktnavn | 4-(Trifluoromethylsulfonyl)benzonitrile |
Engelsk navn | 4-(Trifluoromethylsulfonyl)benzonitrile;4-Cyanophenyl trifluoromethyl sulphone;4-(Trifluoromethylsulphonyl)benzonitrile;4-(Trifluoromethanesulfonyl)benzonitrile |
Molekylær Formel | C6H4FNO |
Molekylvekt | 125.1005 |
InChI | InChI=1/C6H4FNO/c7-5-2-1-3-8-6(5)4-9/h1-4H |
CAS-nummer | 312-21-0 |
Molecular Structure | ![]() |
Tetthet | 1.269g/cm3 |
Smeltepunkt | 84-88℃ |
Kokepunkt | 166.5°C at 760 mmHg |
Brytningsindeks | 1.543 |
Flammepunktet | 54.5°C |
Damptrykk | 1.78mmHg at 25°C |
Risiko Koder | R22##Harmful if swallowed.||R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Sikkerhet Beskrivelse | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
MSDS |