ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
306934-98-5 2-(2-tienyl)-1,3-tiazol-4-karbonylklorid |
|
produktnavn | 2-(2-tienyl)-1,3-tiazol-4-karbonylklorid |
Synonymer | 2-tiofen-2-yl-1,3-tiazol-4-karbonylklorid; |
Engelsk navn | 2-(2-thienyl)-1,3-thiazole-4-carbonyl chloride;2-thiophen-2-yl-1,3-thiazole-4-carbonyl chloride |
Molekylær Formel | C8H4ClNOS2 |
Molekylvekt | 229.7065 |
InChI | InChI=1/C8H4ClNOS2/c9-7(11)5-4-13-8(10-5)6-2-1-3-12-6/h1-4H |
CAS-nummer | 306934-98-5 |
Molecular Structure | ![]() |
Tetthet | 1.498g/cm3 |
Smeltepunkt | 90℃ |
Kokepunkt | 371.6°C at 760 mmHg |
Brytningsindeks | 1.65 |
Flammepunktet | 178.5°C |
Damptrykk | 1.02E-05mmHg at 25°C |
Hazard symboler | |
Risiko Koder | R34##Causes burns.:; |
Sikkerhet Beskrivelse | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |