ChemIndex - En gratis kjemisk CAS-databaseChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
methyl linolenate |
|
produktnavn | methyl linolenate |
Engelsk navn | methyl linolenate; |
Molekylær Formel | C19H32O2 |
Molekylvekt | 292.4562 |
InChI | InChI=1/C19H32O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19(20)21-2/h4-5,7-8,10-11H,3,6,9,12-18H2,1-2H3/b5-4-,8-7-,11-10- |
CAS-nummer | 301-00-8 |
EINECS | 206-102-3 |
Molecular Structure | |
Tetthet | 0.895g/cm3 |
Kokepunkt | 364.4°C at 760 mmHg |
Brytningsindeks | 1.475 |
Flammepunktet | 101.4°C |
Damptrykk | 1.69E-05mmHg at 25°C |
Sikkerhet Beskrivelse | S24/25##Avoid contact with skin and eyes.:; |
MSDS |