ChemIndex - En gratis kjemisk CAS-databaseChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
Arecoline hydrobromide |
|
produktnavn | Arecoline hydrobromide |
Engelsk navn | Arecoline hydrobromide;methyl 1,2,5,6-tetrahydro-1-methyl-3-pyridinecarboxylate hydrobromide;methyl 1-methyl-1,2,5,6-tetrahydropyridine-3-carboxylate hydrobromide (1:1);1-Methyl-1,2,5,6-tetrahydro-3-pyridinecarboxylic acid methyl ester hydrobromide;Arecoline HBr |
Molekylær Formel | C8H14BrNO2 |
Molekylvekt | 236.1063 |
InChI | InChI=1/C8H13NO2.BrH/c1-9-5-3-4-7(6-9)8(10)11-2;/h4H,3,5-6H2,1-2H3;1H |
CAS-nummer | 300-08-3 |
EINECS | 206-087-3 |
Molecular Structure | |
Smeltepunkt | 171-174℃ |
Kokepunkt | 209°C at 760 mmHg |
Flammepunktet | 81.1°C |
Damptrykk | 0.208mmHg at 25°C |
Hazard symboler | Xn##Harmful:; |
Risiko Koder | R22:; |
Sikkerhet Beskrivelse | S28A##After contact with skin, wash immediately with plenty of water.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S38##In case of insufficient ventilation, wear suitable respiratory equipment.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |