ChemIndex - En gratis kjemisk CAS-databaseChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
Cyclooctene oxide |
|
produktnavn | Cyclooctene oxide |
Engelsk navn | Cyclooctene oxide;9-Oxabicyclo[6.1.0]nonane;Epoxycyclooctane~2-Oxabicyclo[6.1.0]nonane;Epoxycyclooctane;(1R,8S)-9-oxabicyclo[6.1.0]nonane;(1R,8R)-9-oxabicyclo[6.1.0]nonane;(1S,8S)-9-oxabicyclo[6.1.0]nonane |
Molekylær Formel | C8H14O |
Molekylvekt | 126.1962 |
InChI | InChI=1/C8H14O/c1-2-4-6-8-7(9-8)5-3-1/h7-8H,1-6H2/t7-,8-/m0/s1 |
CAS-nummer | 286-62-4 |
EINECS | 206-010-3 |
Molecular Structure | |
Tetthet | 0.958g/cm3 |
Smeltepunkt | 53-56℃ |
Kokepunkt | 189.3°C at 760 mmHg |
Brytningsindeks | 1.466 |
Flammepunktet | 56.1°C |
Damptrykk | 0.793mmHg at 25°C |
Hazard symboler | Xn##Harmful:; |
Risiko Koder | R22##Harmful if swallowed.||R36/38##Irritating to eyes and skin.:; |
Sikkerhet Beskrivelse | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
MSDS |