ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
25859-29-4 dekansyre, sammensatt med 2-aminoetanol (1: 1) |
|
produktnavn | dekansyre, sammensatt med 2-aminoetanol (1: 1) |
Synonymer | Dekansyre, sammensatt med 2-aminoetanol (1: 1); 2-hydroksyetanaminiumdekanoat; |
Engelsk navn | decanoic acid, compound with 2-aminoethanol (1:1);Decanoic acid, compound with 2-aminoethanol (1:1);2-hydroxyethanaminium decanoate |
Molekylær Formel | C12H27NO3 |
Molekylvekt | 233.3477 |
InChI | InChI=1/C10H20O2.C2H7NO/c1-2-3-4-5-6-7-8-9-10(11)12;3-1-2-4/h2-9H2,1H3,(H,11,12);4H,1-3H2 |
CAS-nummer | 25859-29-4 |
EINECS | 247-303-6 |
Molecular Structure | ![]() |
Kokepunkt | 411.2°C at 760 mmHg |
Flammepunktet | 202.5°C |
Damptrykk | 1.77E-08mmHg at 25°C |
MSDS |