ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
244-63-3 Norharman |
|
produktnavn | Norharman |
Engelsk navn | Norharman;9H-Pyrido[3,4-B]Indole |
Molekylær Formel | C11H8N2 |
Molekylvekt | 168.1946 |
InChI | InChI=1/C11H8N2/c1-2-4-10-8(3-1)9-5-6-12-7-11(9)13-10/h1-7,13H |
CAS-nummer | 244-63-3 |
EINECS | 205-959-0 |
Molecular Structure | |
Tetthet | 1.301g/cm3 |
Smeltepunkt | 198-202℃ |
Kokepunkt | 391.3°C at 760 mmHg |
Brytningsindeks | 1.784 |
Flammepunktet | 182.1°C |
Damptrykk | 5.62E-06mmHg at 25°C |
Sikkerhet Beskrivelse | S24/25##Avoid contact with skin and eyes.:; |
MSDS |