ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
24171-89-9 Tris(2-thienyl)phosphine |
|
produktnavn | Tris(2-thienyl)phosphine |
Engelsk navn | Tris(2-thienyl)phosphine;Tri(2-thienyl)phosphine;trithiophen-2-ylphosphane |
Molekylær Formel | C12H9PS3 |
Molekylvekt | 280.3686 |
InChI | InChI=1/C12H9PS3/c1-4-10(14-7-1)13(11-5-2-8-15-11)12-6-3-9-16-12/h1-9H |
CAS-nummer | 24171-89-9 |
EINECS | 246-059-8 |
Molecular Structure | ![]() |
Smeltepunkt | 29-30℃ |
Kokepunkt | 375.8°C at 760 mmHg |
Flammepunktet | 181.1°C |
Damptrykk | 1.64E-05mmHg at 25°C |
Sikkerhet Beskrivelse | S24/25##Avoid contact with skin and eyes.:; |
MSDS |