ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
24023-71-0 2-klormetyl-5-(4-metoksyfenyl)-1,2,4-oksadiazol |
|
produktnavn | 2-klormetyl-5-(4-metoksyfenyl)-1,2,4-oksadiazol |
Synonymer | ; 2-(klormetyl)-5-(4-metoksyfenyl)-1,3,4-oksadiazol; |
Engelsk navn | 2-Chloromethyl-5-(4-methoxyphenyl)-1,2,4-oxadiazole;2-(Chloromethyl)-5-(4-methoxyphenyl)-1,3,4-oxadiazole |
Molekylær Formel | C10H9ClN2O2 |
Molekylvekt | 224.6437 |
InChI | InChI=1/C10H9ClN2O2/c1-14-8-4-2-7(3-5-8)10-13-12-9(6-11)15-10/h2-5H,6H2,1H3 |
CAS-nummer | 24023-71-0 |
Molecular Structure | |
Tetthet | 1.278g/cm3 |
Smeltepunkt | 91℃ |
Kokepunkt | 354.9°C at 760 mmHg |
Brytningsindeks | 1.547 |
Flammepunktet | 168.4°C |
Damptrykk | 6.63E-05mmHg at 25°C |
Hazard symboler | Xi##Irritant:; |
Risiko Koder | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Sikkerhet Beskrivelse | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
MSDS |