ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
23132-21-0 2-Bromo-3-methyl-5-nitropyridine |
|
produktnavn | 2-Bromo-3-methyl-5-nitropyridine |
Engelsk navn | 2-Bromo-3-methyl-5-nitropyridine;2-Bromo-5-nitro-3-picoline |
Molekylær Formel | C6H5BrN2O2 |
Molekylvekt | 217.0201 |
InChI | InChI=1/C6H5BrN2O2/c1-4-2-5(9(10)11)3-8-6(4)7/h2-3H,1H3 |
CAS-nummer | 23132-21-0 |
Molecular Structure | |
Tetthet | 1.709g/cm3 |
Kokepunkt | 305.1°C at 760 mmHg |
Brytningsindeks | 1.599 |
Flammepunktet | 138.3°C |
Damptrykk | 0.00151mmHg at 25°C |
Risiko Koder | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Sikkerhet Beskrivelse | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |