ChemIndex - En gratis kjemisk CAS-databaseChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
Phenanthridine |
|
produktnavn | Phenanthridine |
Engelsk navn | Phenanthridine;Phenanthridine;3,4-Benzoquinoline;Phenanthridine, (Benzo[c]quinoline) |
Molekylær Formel | C13H9N |
Molekylvekt | 179.2173 |
InChI | InChI=1/C13H9N/c1-2-6-12-10(4-1)7-8-11-5-3-9-14-13(11)12/h1-9H |
CAS-nummer | 229-87-8 |
EINECS | 205-934-4 |
Molecular Structure | |
Tetthet | 1.187g/cm3 |
Smeltepunkt | 104-107℃ |
Kokepunkt | 340.8°C at 760 mmHg |
Brytningsindeks | 1.726 |
Flammepunktet | 155.9°C |
Damptrykk | 0.000166mmHg at 25°C |
Hazard symboler | Xn##Harmful:; |
Risiko Koder | R40##Possible risks of irreversible effects.:; |
Sikkerhet Beskrivelse | S36/37##Wear suitable protective clothing and gloves.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |