ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
22047-88-7 2-Benzyloxyphenylacetic acid |
|
produktnavn | 2-Benzyloxyphenylacetic acid |
Engelsk navn | 2-Benzyloxyphenylacetic acid;[2-(phenoxymethyl)phenyl]acetic acid |
Molekylær Formel | C15H14O3 |
Molekylvekt | 242.2699 |
InChI | InChI=1/C15H14O3/c16-15(17)10-12-6-4-5-7-13(12)11-18-14-8-2-1-3-9-14/h1-9H,10-11H2,(H,16,17) |
CAS-nummer | 22047-88-7 |
Molecular Structure | |
Tetthet | 1.201g/cm3 |
Kokepunkt | 408.9°C at 760 mmHg |
Brytningsindeks | 1.595 |
Flammepunktet | 154.1°C |
Damptrykk | 2.03E-07mmHg at 25°C |
Risiko Koder | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Sikkerhet Beskrivelse | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |