ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
14922-36-2 4-Nitrophenylglyoxylic acid |
|
produktnavn | 4-Nitrophenylglyoxylic acid |
Engelsk navn | 4-Nitrophenylglyoxylic acid;4-Nitrobenzoylformic acid;(4-nitrophenyl)(oxo)acetic acid |
Molekylær Formel | C8H5NO5 |
Molekylvekt | 195.129 |
InChI | InChI=1/C8H5NO5/c10-7(8(11)12)5-1-3-6(4-2-5)9(13)14/h1-4H,(H,11,12) |
CAS-nummer | 14922-36-2 |
Molecular Structure | |
Tetthet | 1.531g/cm3 |
Kokepunkt | 381.6°C at 760 mmHg |
Brytningsindeks | 1.613 |
Flammepunktet | 173.1°C |
Damptrykk | 1.67E-06mmHg at 25°C |
Risiko Koder | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Sikkerhet Beskrivelse | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |