ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
13090-86-3 benzosyre, forbindelse med 2,2',2''-nitrilotrietanol (1:1) |
|
produktnavn | benzosyre, forbindelse med 2,2',2''-nitrilotrietanol (1:1) |
Synonymer | Benzosyre, sammensatt med 2,2',2''-nitrilotrietanol (1:1); Benzosyre, compd.med 2,2',2''-nitrilotris (etanol) (1:1); 2-hydroksy-N,N-bis(2-hydroksyetyl)etanaminiumbenzoat; |
Engelsk navn | benzoic acid, compound with 2,2',2''-nitrilotriethanol (1:1);Benzoic acid, compound with 2,2',2''-nitrilotriethanol (1:1);Benzoic acid, compd. with 2,2',2''-nitrilotris(ethanol) (1:1);2-hydroxy-N,N-bis(2-hydroxyethyl)ethanaminium benzoate |
Molekylær Formel | C13H21NO5 |
Molekylvekt | 271.3095 |
InChI | InChI=1/C7H6O2.C6H15NO3/c8-7(9)6-4-2-1-3-5-6;8-4-1-7(2-5-9)3-6-10/h1-5H,(H,8,9);8-10H,1-6H2 |
CAS-nummer | 13090-86-3 |
EINECS | 236-002-5 |
Molecular Structure | |
Kokepunkt | 518.5°C at 760 mmHg |
Flammepunktet | 267.4°C |
Damptrykk | 1.41E-11mmHg at 25°C |
MSDS |