Chemindex > 1206-15-1
NO ▼
1206-15-1 1-(4-metoksyfenyl)-1-cyklopentankarbonitril |
|
| produktnavn | 1-(4-metoksyfenyl)-1-cyklopentankarbonitril |
| Synonymer | 1-(4-metoksyfenyl)cyklopentankarbonitril |
| Engelsk navn | 1-(4-Methoxyphenyl)-1-cyclopentanecarbonitrile;1-(4-Methoxyphenyl)cyclopentanecarbonitrile |
| Molekylær Formel | C13H15NO |
| Molekylvekt | 201.2643 |
| InChI | InChI=1/C13H15NO/c1-15-12-6-4-11(5-7-12)13(10-14)8-2-3-9-13/h4-7H,2-3,8-9H2,1H3 |
| CAS-nummer | 1206-15-1 |
| EINECS | 214-890-5 |
| Molecular Structure |  |
| Tetthet | 1.07g/cm3 |
| Kokepunkt | 346.4°C at 760 mmHg |
| Brytningsindeks | 1.543 |
| Flammepunktet | 146.2°C |
| Damptrykk | 5.76E-05mmHg at 25°C |
| Hazard symboler |  Xn##Harmful:; |
| Risiko Koder | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.:; |
| Sikkerhet Beskrivelse | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
| MSDS | |
- Hvis du planlegger å hente kjemikalier fra Kina, er det bare å gå til ChemNet kjøpesenter, vi vil få den nyeste og konkurransedyktige prisen fra kinesiske produsenter for deg.Vennligst besøk
ChemNet Mall
Kjemisk CAS-databasetjeneste leveres av ChemIndex.com 