ChemIndex - En gratis kjemisk CAS-databaseChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
Methyl stearate |
|
produktnavn | Methyl stearate |
Engelsk navn | Methyl stearate;Methyl n-octadecanoate;Stearic acid methyl ester;methyl octadecanoate;Me-ST |
Molekylær Formel | C19H38O2 |
Molekylvekt | 298.5038 |
InChI | InChI=1/C19H38O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19(20)21-2/h3-18H2,1-2H3 |
CAS-nummer | 112-61-8 |
EINECS | 203-990-4 |
Molecular Structure | |
Tetthet | 0.863g/cm3 |
Smeltepunkt | 37-39℃ |
Kokepunkt | 355.5°C at 760 mmHg |
Brytningsindeks | 1.444 |
Flammepunktet | 169.3°C |
Damptrykk | 3.11E-05mmHg at 25°C |
Sikkerhet Beskrivelse | S24/25##Avoid contact with skin and eyes.:; |
MSDS |