ChemIndex - En gratis kjemisk CAS-databaseChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
Methyl 2-nonynoate |
|
produktnavn | Methyl 2-nonynoate |
Engelsk navn | Methyl 2-nonynoate;2-Nonynoic acid methyl ester;2-Nonynoic acid, methyl ester;Methyl octin carbonate;Methyl octine carbonate;Octynecarboxylic acid, methyl ester;methyl non-2-ynoate |
Molekylær Formel | C10H16O2 |
Molekylvekt | 168.2328 |
InChI | InChI=1/C10H16O2/c1-3-4-5-6-7-8-9-10(11)12-2/h3-7H2,1-2H3 |
CAS-nummer | 111-80-8 |
EINECS | 203-909-2 |
Molecular Structure | |
Tetthet | 0.932g/cm3 |
Kokepunkt | 233.1°C at 760 mmHg |
Brytningsindeks | 1.446 |
Flammepunktet | 100.6°C |
Damptrykk | 0.0568mmHg at 25°C |
Hazard symboler | Xi##Irritant:; |
Risiko Koder | R36/38##Irritating to eyes and skin.:; |
Sikkerhet Beskrivelse | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |