ChemIndex - En gratis kjemisk CAS-databaseChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
Triethyleneglycoldiacetate |
|
produktnavn | Triethyleneglycoldiacetate |
Engelsk navn | Triethyleneglycoldiacetate;Triethylene glycol diacetate;ethane-1,2-diylbis(oxyethane-2,1-diyl) diacetate |
Molekylær Formel | C10H18O6 |
Molekylvekt | 234.2463 |
InChI | InChI=1/C10H18O6/c1-9(11)15-7-5-13-3-4-14-6-8-16-10(2)12/h3-8H2,1-2H3 |
CAS-nummer | 111-21-7 |
EINECS | 203-846-0 |
Molecular Structure | |
Tetthet | 1.098g/cm3 |
Kokepunkt | 286°C at 760 mmHg |
Brytningsindeks | 1.432 |
Flammepunktet | 125.2°C |
Damptrykk | 0.00271mmHg at 25°C |
Sikkerhet Beskrivelse | S24/25##Avoid contact with skin and eyes.:; |
MSDS |