ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
106-42-3 p-Xylene |
|
produktnavn | p-Xylene |
Engelsk navn | p-Xylene;1,4-Dimethylbenzene;para-xylene;Dibencoside;1,4-xylene |
Molekylær Formel | C8H10 |
Molekylvekt | 106.1674 |
InChI | InChI:1S/C8H10/c1-7-3-5-8(2)6-4-7/h3-6H,1-2H3 |
CAS-nummer | 106-42-3 |
EINECS | 203-396-5 |
Molecular Structure | |
Smeltepunkt | 13-13℃ |
Kokepunkt | 139.61°C at 760 mmHg |
Flammepunktet | 24.627°C |
Damptrykk | 7.943mmHg at 25°C |
Hazard symboler | Xn##Harmful:; |
Risiko Koder | R10##Flammable.||R20/21##Harmful by inhalation and in contact with skin.||R38##Irritating to skin.:; |
Sikkerhet Beskrivelse | S25##Avoid contact with eyes.:; |
MSDS |