ChemIndex - En gratis kjemisk CAS-databaseChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
1,4-Cyclohexanedimethanol, mixture of cisand trans |
|
produktnavn | 1,4-Cyclohexanedimethanol, mixture of cisand trans |
Engelsk navn | 1,4-Cyclohexanedimethanol, mixture of cisand trans;1,4-Bis(hydroxymethyl)cyclohexane;cyclohex-1,4-ylenedimethanol;1,4-Cyclohexane dimethanol;cyclohexane-1,4-diyldimethanol;1,4-Cyclohexanedimethanol;CHDM |
Molekylær Formel | C8H16O2 |
Molekylvekt | 144.2114 |
InChI | InChI=1/C8H16O2/c9-5-7-1-2-8(6-10)4-3-7/h7-10H,1-6H2 |
CAS-nummer | 105-08-8 |
EINECS | 203-268-9 |
Molecular Structure | |
Tetthet | 1.004g/cm3 |
Smeltepunkt | 31.5℃ |
Kokepunkt | 286.2°C at 760 mmHg |
Brytningsindeks | 1.47 |
Flammepunktet | 161.1°C |
Vannløselighet | miscible |
Damptrykk | 0.000303mmHg at 25°C |
Risiko Koder | R36:; |
Sikkerhet Beskrivelse | S26||S39:; |
MSDS |