ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
103-78-6 cyclohexylacetone |
|
produktnavn | cyclohexylacetone |
Engelsk navn | cyclohexylacetone;Cyclohexylacetone, (Acetonylcyclohexane);Acetonylcyclohexane;Cyclohexyacetone;1-cyclohexylpropan-2-one;1-cyclohexylacetone |
Molekylær Formel | C9H16O |
Molekylvekt | 140.2227 |
InChI | InChI=1/C9H16O/c1-8(10)7-9-5-3-2-4-6-9/h9H,2-7H2,1H3 |
CAS-nummer | 103-78-6 |
EINECS | 203-143-9 |
Molecular Structure | |
Tetthet | 0.889g/cm3 |
Kokepunkt | 188.1°C at 760 mmHg |
Brytningsindeks | 1.441 |
Flammepunktet | 65.3°C |
Damptrykk | 0.609mmHg at 25°C |
Sikkerhet Beskrivelse | S24/25##Avoid contact with skin and eyes.:; |
MSDS |