ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
103-30-0 trans-Stilbene |
|
produktnavn | trans-Stilbene |
Engelsk navn | trans-Stilbene;trans-1,1-(1,2-Ethenediyl)bis(benzene);1,1'-ethene-1,1-diyldibenzene;1,1'-(E)-ethene-1,2-diyldibenzene;1,1'-(Z)-ethene-1,2-diyldibenzene |
Molekylær Formel | C14H12 |
Molekylvekt | 180.2451 |
InChI | InChI=1/C14H12/c1-3-7-13(8-4-1)11-12-14-9-5-2-6-10-14/h1-12H/b12-11- |
CAS-nummer | 103-30-0 |
EINECS | 203-098-5 |
Molecular Structure | ![]() |
Tetthet | 1.044g/cm3 |
Smeltepunkt | 122-126℃ |
Kokepunkt | 307°C at 760 mmHg |
Brytningsindeks | 1.658 |
Flammepunktet | 128.5°C |
Damptrykk | 0.00135mmHg at 25°C |
Sikkerhet Beskrivelse | S24/25##Avoid contact with skin and eyes.:; |
MSDS |