ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
103-19-5 p-Tolyl disulfide |
|
produktnavn | p-Tolyl disulfide |
Engelsk navn | p-Tolyl disulfide; |
Molekylær Formel | C14H14S2 |
Molekylvekt | 246.391 |
InChI | InChI=1/C14H14S2/c1-11-3-7-13(8-4-11)15-16-14-9-5-12(2)6-10-14/h3-10H,1-2H3 |
CAS-nummer | 103-19-5 |
EINECS | 203-087-5 |
Molecular Structure | ![]() |
Tetthet | 1.17g/cm3 |
Smeltepunkt | 43-46℃ |
Kokepunkt | 349.5°C at 760 mmHg |
Brytningsindeks | 1.649 |
Flammepunktet | 192.6°C |
Damptrykk | 9.46E-05mmHg at 25°C |
Hazard symboler | |
Risiko Koder | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Sikkerhet Beskrivelse | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
MSDS |