ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
102-38-5 3-Nitroformanilide |
|
produktnavn | 3-Nitroformanilide |
Engelsk navn | 3-Nitroformanilide;N-(3-nitrophenyl)formamide |
Molekylær Formel | C7H6N2O3 |
Molekylvekt | 166.1341 |
InChI | InChI=1/C7H6N2O3/c10-5-8-6-2-1-3-7(4-6)9(11)12/h1-5H,(H,8,10) |
CAS-nummer | 102-38-5 |
Molecular Structure | |
Tetthet | 1.407g/cm3 |
Kokepunkt | 368.5°C at 760 mmHg |
Brytningsindeks | 1.641 |
Flammepunktet | 176.7°C |
Damptrykk | 1.27E-05mmHg at 25°C |
Risiko Koder | R20/22##Harmful by inhalation and if swallowed.:; |
Sikkerhet Beskrivelse | S22##Do not inhale dust.||S36/37##Wear suitable protective clothing and gloves.:; |
MSDS |