ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
101-99-5 N-Phenylurethane |
|
| produktnavn | N-Phenylurethane |
| Engelsk navn | N-Phenylurethane;Ethyl carbanilate~Ethyl N-phenylcarbamate;ethyl phenylcarbamate |
| Molekylær Formel | C9H11NO2 |
| Molekylvekt | 165.1891 |
| InChI | InChI=1/C9H11NO2/c1-2-12-9(11)10-8-6-4-3-5-7-8/h3-7H,2H2,1H3,(H,10,11) |
| CAS-nummer | 101-99-5 |
| EINECS | 202-995-9 |
| Molecular Structure | ![]() |
| Tetthet | 1.136g/cm3 |
| Kokepunkt | 238°C at 760 mmHg |
| Brytningsindeks | 1.558 |
| Flammepunktet | 79.2°C |
| Damptrykk | 0.0434mmHg at 25°C |
| Risiko Koder | R40##Possible risks of irreversible effects.:; |
| Sikkerhet Beskrivelse | S22##Do not inhale dust.||S36/37##Wear suitable protective clothing and gloves.:; |
| MSDS | |