ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
101-99-5 N-Phenylurethane |
|
produktnavn | N-Phenylurethane |
Engelsk navn | N-Phenylurethane;Ethyl carbanilate~Ethyl N-phenylcarbamate;ethyl phenylcarbamate |
Molekylær Formel | C9H11NO2 |
Molekylvekt | 165.1891 |
InChI | InChI=1/C9H11NO2/c1-2-12-9(11)10-8-6-4-3-5-7-8/h3-7H,2H2,1H3,(H,10,11) |
CAS-nummer | 101-99-5 |
EINECS | 202-995-9 |
Molecular Structure | ![]() |
Tetthet | 1.136g/cm3 |
Kokepunkt | 238°C at 760 mmHg |
Brytningsindeks | 1.558 |
Flammepunktet | 79.2°C |
Damptrykk | 0.0434mmHg at 25°C |
Risiko Koder | R40##Possible risks of irreversible effects.:; |
Sikkerhet Beskrivelse | S22##Do not inhale dust.||S36/37##Wear suitable protective clothing and gloves.:; |
MSDS |