Chemindex > 101-17-7
NO ▼
101-17-7 3-Chlorodiphenylamine |
|
| produktnavn | 3-Chlorodiphenylamine |
| Engelsk navn | 3-Chlorodiphenylamine;Benzenamine, 3-chloro-N-phenyl-;3-chloro-N-phenylaniline;3-Chloro-N-phenyl-benzenamine;N-(3-chlorophenyl)aniline |
| Molekylær Formel | C12H10ClN |
| Molekylvekt | 203.6675 |
| InChI | InChI=1/C12H10ClN/c13-10-5-4-8-12(9-10)14-11-6-2-1-3-7-11/h1-9,14H |
| CAS-nummer | 101-17-7 |
| EINECS | 202-922-0 |
| Molecular Structure |  |
| Tetthet | 1.216g/cm3 |
| Kokepunkt | 337.8°C at 760 mmHg |
| Brytningsindeks | 1.642 |
| Flammepunktet | 147.4°C |
| Damptrykk | 0.000102mmHg at 25°C |
| Risiko Koder | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.:; |
| Sikkerhet Beskrivelse | S28##After contact with skin, wash immediately with plenty of ...||S36/37##Wear suitable protective clothing and gloves.:; |
| MSDS | |
- Hvis du planlegger å hente kjemikalier fra Kina, er det bare å gå til ChemNet kjøpesenter, vi vil få den nyeste og konkurransedyktige prisen fra kinesiske produsenter for deg.Vennligst besøk
ChemNet Mall
Kjemisk CAS-databasetjeneste leveres av ChemIndex.com 