ChemIndex - En gratis kjemisk CAS-databaseChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
m-Vinyltoluene |
|
produktnavn | m-Vinyltoluene |
Engelsk navn | m-Vinyltoluene;3-Methylstyrene;3-Vinyltoluene |
Molekylær Formel | C9H10 |
Molekylvekt | 118.17 |
InChI | InChI=1/C9H10/c1-3-9-6-4-5-8(2)7-9/h3-7H,1H2,2H3 |
CAS-nummer | 100-80-1 |
EINECS | 202-889-2 |
Molecular Structure | |
Tetthet | 170 |
Kokepunkt | 171℃ |
Risiko Koder | R10##Flammable.||R20##Harmful by inhalation.||R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Sikkerhet Beskrivelse | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |