ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
99-14-9 Tricarballylic acid |
|
Naam product | Tricarballylic acid |
Engelse naam | Tricarballylic acid;1,2,3-Propanetricarboxylic acid;3-Carboxyglutaric acid;1,2,3-Propanetricarboxylic acid;propane-1,2,3-tricarboxylic acid |
MF | C6H8O6 |
Molecuulgewicht | 176.1241 |
InChI | InChI=1/C6H8O6/c7-4(8)1-3(6(11)12)2-5(9)10/h3H,1-2H2,(H,7,8)(H,9,10)(H,11,12) |
CAS-nummer | 99-14-9 |
EINECS | 202-733-3 |
Moleculaire Structuur | |
Dichtheid | 1.574g/cm3 |
Smeltpunt | 154-159℃ |
Kookpunt | 266.4°C at 760 mmHg |
Brekingsindex | 1.529 |
Vlampunt | 129.2°C |
Dampdruk | 0.00249mmHg at 25°C |
Veiligheid Omschrijving | S24/25##Avoid contact with skin and eyes.:; |
MSDS |