ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
98-81-7 alpha-bromostyrene |
|
Naam product | alpha-bromostyrene |
Engelse naam | alpha-bromostyrene;1-(1-Bromovinyl)benzene;(1-bromoethenyl)benzene |
MF | C8H7Br |
Molecuulgewicht | 183.0452 |
InChI | InChI=1/C8H7Br/c1-7(9)8-5-3-2-4-6-8/h2-6H,1H2 |
CAS-nummer | 98-81-7 |
EINECS | 202-702-4 |
Moleculaire Structuur | |
Dichtheid | 1.387g/cm3 |
Smeltpunt | -44℃ |
Kookpunt | 212.6°C at 760 mmHg |
Brekingsindex | 1.574 |
Vlampunt | 98.3°C |
Dampdruk | 0.249mmHg at 25°C |
Gevaarsymbolen | Xi##Irritant:; |
Risico-codes | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Veiligheid Omschrijving | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
MSDS |