ChemIndex - Een gratis chemische CAS-databaseChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
2-Ethyl-1-butanol |
|
Naam product | 2-Ethyl-1-butanol |
Engelse naam | 2-Ethyl-1-butanol;2-Ethylbutyl alcohol;2-ethylbutan-1-ol |
MF | C6H14O |
Molecuulgewicht | 102.1748 |
InChI | InChI=1/C6H14O/c1-3-6(4-2)5-7/h6-7H,3-5H2,1-2H3 |
CAS-nummer | 97-95-0 |
EINECS | 202-621-4 |
Moleculaire Structuur | |
Dichtheid | 0.814g/cm3 |
Smeltpunt | -15℃ |
Kookpunt | 146.5°C at 760 mmHg |
Brekingsindex | 1.413 |
Vlampunt | 58.3°C |
Dampdruk | 1.81mmHg at 25°C |
Gevaarsymbolen | Xn##Harmful:; |
Risico-codes | R21/22##Harmful in contact with skin and if swallowed.:; |
MSDS |